2,7-dibromo-9,9-di(octan-3-yl)fluorene
Modify Date: 2026-07-17 10:29:00
2,7-dibromo-9,9-di(octan-3-yl)fluorene structure
|
Common Name | 2,7-dibromo-9,9-di(octan-3-yl)fluorene | ||
|---|---|---|---|---|
| CAS Number | 950526-43-9 | Molecular Weight | 548.43600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H40Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-dibromo-9,9-di(octan-3-yl)fluorene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C29H40Br2 |
|---|---|
| Molecular Weight | 548.43600 |
| Exact Mass | 546.15000 |
| LogP | 10.69110 |
| InChIKey | DZHATJPATRSFQG-UHFFFAOYSA-N |
| SMILES | CCCCCC(CC)C1(C(CC)CCCCC)c2cc(Br)ccc2-c2ccc(Br)cc21 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,7-dibromo-9,9-bis(1-ethylhexyl)-9h-fluorene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,7-dibromo-9,9-di(octan-3-yl)fluorene? |
| A: SMILES notation of 2,7-dibromo-9,9-di(octan-3-yl)fluorene is CCCCCC(CC)C1(C(CC)CCCCC)c2cc(Br)ccc2-c2ccc(Br)cc21. |
| Q: What is the English name of 2,7-dibromo-9,9-di(octan-3-yl)fluorene? |
| A: The English name of 2,7-dibromo-9,9-di(octan-3-yl)fluorene is 2,7-dibromo-9,9-di(octan-3-yl)fluorene. |
| Q: What English synonyms does 2,7-dibromo-9,9-di(octan-3-yl)fluorene have? |
| A: English synonyms of 2,7-dibromo-9,9-di(octan-3-yl)fluorene: 2,7-dibromo-9,9-bis(1-ethylhexyl)-9h-fluorene. |
| Q: What is the Chinese name of 950526-43-9? |
| A: Chinese name of 950526-43-9 is 950526-43-9. |
| Q: What is the LogP of 2,7-dibromo-9,9-di(octan-3-yl)fluorene? |
| A: LogP of 2,7-dibromo-9,9-di(octan-3-yl)fluorene is 10.69110. |
| Q: What is the molecular weight of 2,7-dibromo-9,9-di(octan-3-yl)fluorene? |
| A: Molecular weight of 2,7-dibromo-9,9-di(octan-3-yl)fluorene is 548.43600. |
| Q: What is the molecular formula of 2,7-dibromo-9,9-di(octan-3-yl)fluorene? |
| A: Molecular formula of 2,7-dibromo-9,9-di(octan-3-yl)fluorene is C29H40Br2. |
| Q: What is the CAS number of 2,7-dibromo-9,9-di(octan-3-yl)fluorene? |
| A: CAS number of 2,7-dibromo-9,9-di(octan-3-yl)fluorene is 950526-43-9. |
| Q: What is the InChIKey of 2,7-dibromo-9,9-di(octan-3-yl)fluorene? |
| A: InChIKey of 2,7-dibromo-9,9-di(octan-3-yl)fluorene is DZHATJPATRSFQG-UHFFFAOYSA-N. |