(4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole)
Modify Date: 2025-09-09 20:08:51
(4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) structure
|
Common Name | (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) | ||
|---|---|---|---|---|
| CAS Number | 950596-41-5 | Molecular Weight | 439.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H29N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H29N3O2 |
|---|---|
| Molecular Weight | 439.5 |
| InChIKey | RMLOXCKHASDXND-DQEYMECFSA-N |
| SMILES | CC(Cc1ccccn1)(C1=NC(Cc2ccccc2)CO1)C1=NC(Cc2ccccc2)CO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole)? |
| A: Molecular formula of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) is C28H29N3O2. |
| Q: What is the molecular weight of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole)? |
| A: Molecular weight of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) is 439.5. |
| Q: What is the SMILES notation of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole)? |
| A: SMILES notation of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) is CC(Cc1ccccn1)(C1=NC(Cc2ccccc2)CO1)C1=NC(Cc2ccccc2)CO1. |
| Q: What is the CAS number of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole)? |
| A: CAS number of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) is 950596-41-5. |
| Q: What is the InChIKey of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole)? |
| A: InChIKey of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) is RMLOXCKHASDXND-DQEYMECFSA-N. |
| Q: What is the Chinese name of 950596-41-5? |
| A: Chinese name of 950596-41-5 is 950596-41-5. |
| Q: What is the English name of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole)? |
| A: The English name of (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole) is (4S,4'S)-2,2'-(1-(Pyridin-2-yl)propane-2,2-diyl)bis(4-Benzyl-4,5-dihydrooxazole). |