3-(4-Piperidinyloxy)benzonitrile hydrochloride structure
|
Common Name | 3-(4-Piperidinyloxy)benzonitrile hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 950649-07-7 | Molecular Weight | 238.713 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-piperidin-4-yloxybenzonitrile,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15ClN2O |
|---|---|
| Molecular Weight | 238.713 |
| Exact Mass | 238.087296 |
| PSA | 45.05000 |
| LogP | 2.81988 |
| InChIKey | YRNQJNMHJHPFRA-UHFFFAOYSA-N |
| SMILES | Cl.N#Cc1cccc(OC2CCNCC2)c1 |
| HS Code | 2933399090 |
|---|
|
~%
3-(4-Piperidiny... CAS#:950649-07-7 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; BOEHRINGER INGELHEIM PHARMA GMBH and CO. KG Patent: WO2007/106705 A1, 2007 ; Location in patent: Page/Page column 100 ; WO 2007/106705 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(4-Piperidinyloxy)benzonitrile hydrochloride (1:1) |
| Benzonitrile, 3-(4-piperidinyloxy)-, hydrochloride (1:1) |