4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one
4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one structure
|
Common Name | 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 95068-31-8 | Molecular Weight | 270.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14O4 |
|---|---|
| Molecular Weight | 270.28000 |
| Exact Mass | 270.08900 |
| PSA | 44.76000 |
| LogP | 2.96360 |
| InChIKey | QQYLQACYTOABJN-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C1OC(=O)c2cccc(OC)c21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~60%
4-methoxy-3-(2-... CAS#:95068-31-8 |
| Literature: Epsztajn; Bieniek; Kowalska; Kulikiewicz Synthesis, 2000 , # 11 p. 1603 - 1607 |
|
~%
4-methoxy-3-(2-... CAS#:95068-31-8 |
| Literature: Bieniek, Adam; Epsztajn, Jan; Kulikiewicz, Krystyna K. Synthetic Communications, 2003 , vol. 33, # 4 p. 667 - 677 |
|
~%
4-methoxy-3-(2-... CAS#:95068-31-8 |
| Literature: Bieniek, Adam; Epsztajn, Jan; Kulikiewicz, Krystyna K. Synthetic Communications, 2003 , vol. 33, # 4 p. 667 - 677 |
|
~%
4-methoxy-3-(2-... CAS#:95068-31-8 |
| Literature: Bieniek, Adam; Epsztajn, Jan; Kulikiewicz, Krystyna K. Synthetic Communications, 2003 , vol. 33, # 4 p. 667 - 677 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1(3H)-Isobenzofuranone,4-methoxy-3-(2-methoxyphenyl) |
| 3-(2-Methoxyphenyl)-4-methoxy-3H-isobenzofuran-1-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one? |
| A: Molecular weight of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one is 270.28000. |
| Q: What is the molecular formula of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one? |
| A: Molecular formula of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one is C16H14O4. |
| Q: What is the Chinese name of 95068-31-8? |
| A: Chinese name of 95068-31-8 is 95068-31-8. |
| Q: What English synonyms does 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one have? |
| A: English synonyms of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one: 1(3H)-Isobenzofuranone,4-methoxy-3-(2-methoxyphenyl), 3-(2-Methoxyphenyl)-4-methoxy-3H-isobenzofuran-1-one. |
| Q: What is the LogP of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one? |
| A: LogP of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one is 2.96360. |
| Q: What is the CAS number of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one? |
| A: CAS number of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one is 95068-31-8. |
| Q: What is the polar surface area (PSA) of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one? |
| A: Polar surface area (PSA) of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one is 44.76000. |
| Q: What is the English name of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one? |
| A: The English name of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one is 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one. |
| Q: What is the SMILES notation of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one? |
| A: SMILES notation of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one is COc1ccccc1C1OC(=O)c2cccc(OC)c21. |
| Q: What is the InChIKey of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one? |
| A: InChIKey of 4-methoxy-3-(2-methoxyphenyl)-3H-2-benzofuran-1-one is QQYLQACYTOABJN-UHFFFAOYSA-N. |