Spiro[4.6]undecane-2-carbonyl chloride (9CI)
![Spiro[4.6]undecane-2-carbonyl chloride (9CI) Structure](https://image.chemsrc.com/caspic/195/95070-39-6.png)
Spiro[4.6]undecane-2-carbonyl chloride (9CI) structure
|
Common Name | Spiro[4.6]undecane-2-carbonyl chloride (9CI) | ||
|---|---|---|---|---|
| CAS Number | 95070-39-6 | Molecular Weight | 214.73200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | spiro[4.6]undecane-3-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19ClO |
|---|---|
| Molecular Weight | 214.73200 |
| Exact Mass | 214.11200 |
| PSA | 17.07000 |
| LogP | 3.89250 |
| InChIKey | HZGJMMJPEYTLBW-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C1CCC2(CCCCCC2)C1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916209090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![spiro[4.6]undecane-2-carboxylic acid structure](https://image.chemsrc.com/caspic/233/95070-38-5.png)
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| spiro[4.6]undecane-2-carbonyl chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 95070-39-6? |
| A: Chinese name of 95070-39-6 is 95070-39-6. |
| Q: What is the English name of spiro[4.6]undecane-3-carbonyl chloride? |
| A: The English name of spiro[4.6]undecane-3-carbonyl chloride is spiro[4.6]undecane-3-carbonyl chloride. |
| Q: What is the SMILES notation of spiro[4.6]undecane-3-carbonyl chloride? |
| A: SMILES notation of spiro[4.6]undecane-3-carbonyl chloride is O=C(Cl)C1CCC2(CCCCCC2)C1. |
| Q: What is the InChIKey of spiro[4.6]undecane-3-carbonyl chloride? |
| A: InChIKey of spiro[4.6]undecane-3-carbonyl chloride is HZGJMMJPEYTLBW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of spiro[4.6]undecane-3-carbonyl chloride? |
| A: Molecular formula of spiro[4.6]undecane-3-carbonyl chloride is C12H19ClO. |
| Q: What English synonyms does spiro[4.6]undecane-3-carbonyl chloride have? |
| A: English synonyms of spiro[4.6]undecane-3-carbonyl chloride: spiro[4.6]undecane-2-carbonyl chloride. |
| Q: What is the polar surface area (PSA) of spiro[4.6]undecane-3-carbonyl chloride? |
| A: Polar surface area (PSA) of spiro[4.6]undecane-3-carbonyl chloride is 17.07000. |
| Q: What is the LogP of spiro[4.6]undecane-3-carbonyl chloride? |
| A: LogP of spiro[4.6]undecane-3-carbonyl chloride is 3.89250. |
| Q: What is the molecular weight of spiro[4.6]undecane-3-carbonyl chloride? |
| A: Molecular weight of spiro[4.6]undecane-3-carbonyl chloride is 214.73200. |
| Q: What is the CAS number of spiro[4.6]undecane-3-carbonyl chloride? |
| A: CAS number of spiro[4.6]undecane-3-carbonyl chloride is 95070-39-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |