methyl 12-oxooctadec-10-ynoate
methyl 12-oxooctadec-10-ynoate structure
|
Common Name | methyl 12-oxooctadec-10-ynoate | ||
|---|---|---|---|---|
| CAS Number | 95080-06-1 | Molecular Weight | 308.45600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 12-oxooctadec-10-ynoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H32O3 |
|---|---|
| Molecular Weight | 308.45600 |
| Exact Mass | 308.23500 |
| PSA | 43.37000 |
| LogP | 4.82310 |
| InChIKey | JHLGBIOILJKNNK-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)C#CCCCCCCCCC(=O)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
methyl 12-oxooc... CAS#:95080-06-1 |
| Literature: Frankel, Edwin N.; Garwood, Robert F.; Khambay, Bhupinder P. S.; Moss, Gerard P.; Weedon, Basil C. L. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 10 p. 2233 - 2240 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 10-Octadecynoic acid,12-oxo-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 12-oxooctadec-10-ynoate? |
| A: Molecular weight of methyl 12-oxooctadec-10-ynoate is 308.45600. |
| Q: What is the LogP of methyl 12-oxooctadec-10-ynoate? |
| A: LogP of methyl 12-oxooctadec-10-ynoate is 4.82310. |
| Q: What English synonyms does methyl 12-oxooctadec-10-ynoate have? |
| A: English synonyms of methyl 12-oxooctadec-10-ynoate: 10-Octadecynoic acid,12-oxo-,methyl ester. |
| Q: What is the English name of methyl 12-oxooctadec-10-ynoate? |
| A: The English name of methyl 12-oxooctadec-10-ynoate is methyl 12-oxooctadec-10-ynoate. |
| Q: What is the Chinese name of 95080-06-1? |
| A: Chinese name of 95080-06-1 is 95080-06-1. |
| Q: What is the SMILES notation of methyl 12-oxooctadec-10-ynoate? |
| A: SMILES notation of methyl 12-oxooctadec-10-ynoate is CCCCCCC(=O)C#CCCCCCCCCC(=O)OC. |
| Q: What is the InChIKey of methyl 12-oxooctadec-10-ynoate? |
| A: InChIKey of methyl 12-oxooctadec-10-ynoate is JHLGBIOILJKNNK-UHFFFAOYSA-N. |
| Q: What is the CAS number of methyl 12-oxooctadec-10-ynoate? |
| A: CAS number of methyl 12-oxooctadec-10-ynoate is 95080-06-1. |
| Q: What is the polar surface area (PSA) of methyl 12-oxooctadec-10-ynoate? |
| A: Polar surface area (PSA) of methyl 12-oxooctadec-10-ynoate is 43.37000. |
| Q: What is the molecular formula of methyl 12-oxooctadec-10-ynoate? |
| A: Molecular formula of methyl 12-oxooctadec-10-ynoate is C19H32O3. |