N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide
Modify Date: 2025-11-05 00:20:39
![N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide Structure](https://www.chemsrc.com/extcaspic/330/95082-35-2.png)
N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide structure
|
Common Name | N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 95082-35-2 | Molecular Weight | 249.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15N3OS |
|---|---|
| Molecular Weight | 249.33 |
| InChIKey | JADYERCEZASDCW-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCn1ccnc1)c1cccs1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of thromboxane formation at a concentration of 10e -4 M.
Source: ChEMBL
Target: Thromboxane-A synthase
External Id: CHEMBL814406
|
|
Name: Antihypertensive activity in spontaneously hypertensive rats (SHR) at 100 mg/kg peror...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL792583
|
|
Name: Inhibition of thromboxane formation at a concentration of 10e -6 M.
Source: ChEMBL
Target: Thromboxane-A synthase
External Id: CHEMBL814405
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 95082-35-2? |
| A: Chinese name of 95082-35-2 is 95082-35-2. |
| Q: What is the English name of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide? |
| A: The English name of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide is N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide. |
| Q: What is the SMILES notation of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide? |
| A: SMILES notation of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide is O=C(NCCCCn1ccnc1)c1cccs1. |
| Q: What is the molecular weight of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide? |
| A: Molecular weight of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide is 249.33. |
| Q: What is the InChIKey of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide? |
| A: InChIKey of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide is JADYERCEZASDCW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide? |
| A: Molecular formula of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide is C12H15N3OS. |
| Q: What is the CAS number of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide? |
| A: CAS number of N-[4-(1H-imidazol-1-yl)butyl]thiophene-2-carboxamide is 95082-35-2. |