1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide
Modify Date: 2026-09-24 23:10:25
1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide structure
|
Common Name | 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 95092-09-4 | Molecular Weight | 219.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28 |
| InChIKey | RLXLZYHFTIATIP-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)C1CCCc2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide? |
| A: The English name of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide is 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide. |
| Q: What is the molecular weight of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide? |
| A: Molecular weight of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide is 219.28. |
| Q: What is the InChIKey of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide? |
| A: InChIKey of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide is RLXLZYHFTIATIP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 95092-09-4? |
| A: Chinese name of 95092-09-4 is 95092-09-4. |
| Q: What is the molecular formula of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide? |
| A: Molecular formula of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide is C13H17NO2. |
| Q: What is the SMILES notation of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide? |
| A: SMILES notation of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide is CON(C)C(=O)C1CCCc2ccccc21. |
| Q: What is the CAS number of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide? |
| A: CAS number of 1,2,3,4-Tetrahydro-N-methoxy-N-methyl-1-naphthalenecarboxamide is 95092-09-4. |