4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid
4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid structure
|
Common Name | 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 95092-75-4 | Molecular Weight | 321.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H15NO4 |
|---|---|
| Molecular Weight | 321.32700 |
| Exact Mass | 321.10000 |
| PSA | 75.63000 |
| LogP | 4.35970 |
| InChIKey | WSKDOFYHWRAHIC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)O)c2ccccc12)OCc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~55%
4-(phenylmethox... CAS#:95092-75-4 |
| Literature: Nakayama; Okutome; Matsui; Kurumi; Sakurai; Aoyama; Fujii Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3968 - 3980 |
|
~%
4-(phenylmethox... CAS#:95092-75-4 |
| Literature: Nakayama; Okutome; Matsui; Kurumi; Sakurai; Aoyama; Fujii Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3968 - 3980 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(benzyloxycarbonyl)amino-1-naphthoic acid |
| 1-Naphthalenecarboxylic acid,4-[[(phenylmethoxy)carbonyl]amino] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid have? |
| A: English synonyms of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid: 4-(benzyloxycarbonyl)amino-1-naphthoic acid, 1-Naphthalenecarboxylic acid,4-[[(phenylmethoxy)carbonyl]amino]. |
| Q: What is the molecular formula of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid? |
| A: Molecular formula of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid is C19H15NO4. |
| Q: What is the Chinese name of 95092-75-4? |
| A: Chinese name of 95092-75-4 is 95092-75-4. |
| Q: What is the molecular weight of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid? |
| A: Molecular weight of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid is 321.32700. |
| Q: What is the InChIKey of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid? |
| A: InChIKey of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid is WSKDOFYHWRAHIC-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid? |
| A: Polar surface area (PSA) of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid is 75.63000. |
| Q: What is the LogP of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid? |
| A: LogP of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid is 4.35970. |
| Q: What is the SMILES notation of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid? |
| A: SMILES notation of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid is O=C(Nc1ccc(C(=O)O)c2ccccc12)OCc1ccccc1. |
| Q: What is the CAS number of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid? |
| A: CAS number of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid is 95092-75-4. |
| Q: What is the English name of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid? |
| A: The English name of 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid is 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid. |