4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid structure
|
Common Name | 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 95092-75-4 | Molecular Weight | 321.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(phenylmethoxycarbonylamino)naphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H15NO4 |
|---|---|
| Molecular Weight | 321.32700 |
| Exact Mass | 321.10000 |
| PSA | 75.63000 |
| LogP | 4.35970 |
| InChIKey | WSKDOFYHWRAHIC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)O)c2ccccc12)OCc1ccccc1 |
|
~55%
4-(phenylmethox... CAS#:95092-75-4 |
| Literature: Nakayama; Okutome; Matsui; Kurumi; Sakurai; Aoyama; Fujii Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3968 - 3980 |
|
~%
4-(phenylmethox... CAS#:95092-75-4 |
| Literature: Nakayama; Okutome; Matsui; Kurumi; Sakurai; Aoyama; Fujii Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3968 - 3980 |
| 4-(benzyloxycarbonyl)amino-1-naphthoic acid |
| 1-Naphthalenecarboxylic acid,4-[[(phenylmethoxy)carbonyl]amino] |