2-(2,4-dinitrophenyl)guanidine
2-(2,4-dinitrophenyl)guanidine structure
|
Common Name | 2-(2,4-dinitrophenyl)guanidine | ||
|---|---|---|---|---|
| CAS Number | 951-66-6 | Molecular Weight | 225.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,4-dinitrophenyl)guanidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H7N5O4 |
|---|---|
| Molecular Weight | 225.16200 |
| Exact Mass | 225.05000 |
| PSA | 153.54000 |
| LogP | 2.72780 |
| InChIKey | IWJYFEZGFUWRAF-UHFFFAOYSA-N |
| SMILES | NC(N)=Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(2,4-dinitrop... CAS#:951-66-6 |
| Literature: Heesing,A.; Schmaldt,W. Chemische Berichte, 1978 , vol. 111, p. 320 - 334 |
|
~%
2-(2,4-dinitrop... CAS#:951-66-6 |
| Literature: Hebrard,P.; Olomucki,M. Bulletin de la Societe Chimique de France, 1970 , p. 1938 - 1942 |
![hydroxy-oxo-[(N-phenylcarbamimidoyl)amino]azanium structure](https://image.chemsrc.com/caspic/295/5461-83-6.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Guanidine,(2,4-dinitrophenyl) |
| 1-(2,4-Dinitro-phenyl)-guanidin |
| N-(2,4-Dinitrophenyl)guanidin |
| N-(2,4-Dinitrophenyl)guanidine |
| 1-[2,4-Dinitrophenyl]guanidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 951-66-6? |
| A: Chinese name of 951-66-6 is 951-66-6. |
| Q: What is the InChIKey of 2-(2,4-dinitrophenyl)guanidine? |
| A: InChIKey of 2-(2,4-dinitrophenyl)guanidine is IWJYFEZGFUWRAF-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(2,4-dinitrophenyl)guanidine? |
| A: LogP of 2-(2,4-dinitrophenyl)guanidine is 2.72780. |
| Q: What is the CAS number of 2-(2,4-dinitrophenyl)guanidine? |
| A: CAS number of 2-(2,4-dinitrophenyl)guanidine is 951-66-6. |
| Q: What is the SMILES notation of 2-(2,4-dinitrophenyl)guanidine? |
| A: SMILES notation of 2-(2,4-dinitrophenyl)guanidine is NC(N)=Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the molecular formula of 2-(2,4-dinitrophenyl)guanidine? |
| A: Molecular formula of 2-(2,4-dinitrophenyl)guanidine is C7H7N5O4. |
| Q: What is the molecular weight of 2-(2,4-dinitrophenyl)guanidine? |
| A: Molecular weight of 2-(2,4-dinitrophenyl)guanidine is 225.16200. |
| Q: What is the polar surface area (PSA) of 2-(2,4-dinitrophenyl)guanidine? |
| A: Polar surface area (PSA) of 2-(2,4-dinitrophenyl)guanidine is 153.54000. |
| Q: What English synonyms does 2-(2,4-dinitrophenyl)guanidine have? |
| A: English synonyms of 2-(2,4-dinitrophenyl)guanidine: Guanidine,(2,4-dinitrophenyl), 1-(2,4-Dinitro-phenyl)-guanidin, N-(2,4-Dinitrophenyl)guanidin, N-(2,4-Dinitrophenyl)guanidine, 1-[2,4-Dinitrophenyl]guanidine. |
| Q: What is the English name of 2-(2,4-dinitrophenyl)guanidine? |
| A: The English name of 2-(2,4-dinitrophenyl)guanidine is 2-(2,4-dinitrophenyl)guanidine. |