N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide
Modify Date: 2026-08-03 18:41:35
N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide structure
|
Common Name | N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 951027-34-2 | Molecular Weight | 357.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H14Cl2N2O |
|---|---|
| Molecular Weight | 357.2 |
| InChIKey | PMDIOKYHWAGJFZ-UHFFFAOYSA-N |
| SMILES | O=C(c1cc(Cl)ncc1Cl)N(Cc1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide? |
| A: CAS number of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide is 951027-34-2. |
| Q: What is the molecular weight of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide? |
| A: Molecular weight of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide is 357.2. |
| Q: What is the SMILES notation of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide? |
| A: SMILES notation of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide is O=C(c1cc(Cl)ncc1Cl)N(Cc1ccccc1)c1ccccc1. |
| Q: What is the Chinese name of 951027-34-2? |
| A: Chinese name of 951027-34-2 is 951027-34-2. |
| Q: What is the InChIKey of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide? |
| A: InChIKey of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide is PMDIOKYHWAGJFZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide? |
| A: Molecular formula of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide is C19H14Cl2N2O. |
| Q: What is the English name of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide? |
| A: The English name of N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide is N-benzyl-2,5-dichloro-N-phenylpyridine-4-carboxamide. |