3-Benzylidene-2-oxo-cyclopentanecarboxylic acid ethyl ester structure
|
Common Name | 3-Benzylidene-2-oxo-cyclopentanecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 95127-15-4 | Molecular Weight | 244.28600 | |
| Density | 1.179g/cm3 | Boiling Point | 384ºC at 760mmHg | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.1ºC | |
| Name | 3-Benzylidene-2-oxo-cyclopentanecarboxylic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 384ºC at 760mmHg |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.28600 |
| Flash Point | 170.1ºC |
| Exact Mass | 244.11000 |
| PSA | 43.37000 |
| LogP | 2.61220 |
| Index of Refraction | 1.585 |
| InChIKey | KHALZHFCWRDVCU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(=Cc2ccccc2)C1=O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| benzylidene-(4-benzylsulfanyl-2-phenyl-oxazol-5-yl)-amine |
| methyl 3-(hydroxy(phenyl)methyl)-2-oxocyclopentanecarboxylate |
| N-(4-BENZYLSULFANYL-2-PHENYL-1,3-OXAZOL-5-YL)-1-PHENYL-METHANIMINE |
| 3-Benzyliden-1-aethoxycarbonyl-cyclopentanon-(2) |
| 5-Benzylidenamino-4-benzylmercapto-2-phenyl-oxazol |
| 5-Benzyliden-cyclopentanon-carbonsaeure-(2)-aethylester |