2-(4-Benzyloxyphenyl)chromone structure
|
Common Name | 2-(4-Benzyloxyphenyl)chromone | ||
|---|---|---|---|---|
| CAS Number | 95161-87-8 | Molecular Weight | 328.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-Benzyloxyphenyl)chromone |
|---|
| Molecular Formula | C22H16O3 |
|---|---|
| Molecular Weight | 328.4 |
| InChIKey | JZGKNOHKJDYNJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=CC(=O)C4=CC=CC=C4O3 |
|
Name: Minimum inhibitory concentration, that inhibits growth of Staphylococcus aureus in th...
Source: ChEMBL
Target: Staphylococcus aureus
External Id: CHEMBL804044
|