4-Nitro-2-(trifluoromethyl)pyridine structure
|
Common Name | 4-Nitro-2-(trifluoromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 951627-69-3 | Molecular Weight | 192.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Nitro-2-(trifluoromethyl)pyridine |
|---|
| Molecular Formula | C6H3F3N2O2 |
|---|---|
| Molecular Weight | 192.09500 |
| Exact Mass | 192.01500 |
| PSA | 58.71000 |
| LogP | 2.53180 |
| InChIKey | OWICTKSPALFYDS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccnc(C(F)(F)F)c1 |
| HS Code | 2933399090 |
|---|
|
~%
4-Nitro-2-(trif... CAS#:951627-69-3 |
| Literature: ASTRAZENECA AB Patent: US2009/170849 A1, 2009 ; Location in patent: Page/Page column 14 ; US 20090170849 A1 |
|
~13%
4-Nitro-2-(trif... CAS#:951627-69-3 |
| Literature: Oguro, Yuya; Miyamoto, Naoki; Takagi, Terufumi; Okada, Kengo; Awazu, Yoshiko; Miki, Hiroshi; Hori, Akira; Kamiyama, Keiji; Imamura, Shinichi Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 20 p. 7150 - 7163 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |