4-chloro-2-methyl-6-(trifluoromethoxy)quinoline
Modify Date: 2025-09-01 07:23:48
4-chloro-2-methyl-6-(trifluoromethoxy)quinoline structure
|
Common Name | 4-chloro-2-methyl-6-(trifluoromethoxy)quinoline | ||
|---|---|---|---|---|
| CAS Number | 951905-08-1 | Molecular Weight | 261.62800 | |
| Density | 1.411g/cm3 | Boiling Point | 272.1ºC at 760 mmHg | |
| Molecular Formula | C11H7ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.4ºC | |
| Name | 4-chloro-2-methyl-6-(trifluoromethoxy)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 272.1ºC at 760 mmHg |
| Molecular Formula | C11H7ClF3NO |
| Molecular Weight | 261.62800 |
| Flash Point | 118.4ºC |
| Exact Mass | 261.01700 |
| PSA | 22.12000 |
| LogP | 4.09520 |
| Index of Refraction | 1.549 |
| InChIKey | BFAWSTLWKOKDEZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c2cc(OC(F)(F)F)ccc2n1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-2-methyl-6-trifluoromethoxyquinoline |