3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid
Modify Date: 2026-07-14 20:42:40
![3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/178/951908-88-6.png)
3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid structure
|
Common Name | 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 951908-88-6 | Molecular Weight | 272.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12N2O2S |
|---|---|
| Molecular Weight | 272.32 |
| InChIKey | KGAHUYYTLLONPE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cn3c(C)c(C(=O)O)sc3n2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid? |
| A: CAS number of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid is 951908-88-6. |
| Q: What is the English name of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid? |
| A: The English name of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid is 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid. |
| Q: What is the SMILES notation of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid? |
| A: SMILES notation of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid is Cc1ccc(-c2cn3c(C)c(C(=O)O)sc3n2)cc1. |
| Q: What is the Chinese name of 951908-88-6? |
| A: Chinese name of 951908-88-6 is 951908-88-6. |
| Q: What is the molecular formula of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid? |
| A: Molecular formula of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid is C14H12N2O2S. |
| Q: What is the InChIKey of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid? |
| A: InChIKey of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid is KGAHUYYTLLONPE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid? |
| A: Molecular weight of 3-Methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid is 272.32. |