7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide
Modify Date: 2026-09-25 17:32:26
7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide structure
|
Common Name | 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 951945-76-9 | Molecular Weight | 288.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12N2O3S |
|---|---|
| Molecular Weight | 288.32 |
| InChIKey | UMVUTSXIJVAFLA-UHFFFAOYSA-N |
| SMILES | COc1cccc2cc(C(=O)Nc3ncc(C)s3)oc12 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide? |
| A: SMILES notation of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide is COc1cccc2cc(C(=O)Nc3ncc(C)s3)oc12. |
| Q: What is the Chinese name of 951945-76-9? |
| A: Chinese name of 951945-76-9 is 951945-76-9. |
| Q: What is the InChIKey of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide? |
| A: InChIKey of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide is UMVUTSXIJVAFLA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide? |
| A: Molecular formula of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide is C14H12N2O3S. |
| Q: What is the molecular weight of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide? |
| A: Molecular weight of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide is 288.32. |
| Q: What is the English name of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide? |
| A: The English name of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide is 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide. |
| Q: What is the CAS number of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide? |
| A: CAS number of 7-methoxy-N-(5-methyl-1,3-thiazol-2-yl)-1-benzofuran-2-carboxamide is 951945-76-9. |