6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Modify Date: 2026-08-19 18:05:23
![6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole Structure](https://www.chemsrc.com/extcaspic/135/951949-15-8.png)
6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole structure
|
Common Name | 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole | ||
|---|---|---|---|---|
| CAS Number | 951949-15-8 | Molecular Weight | 393.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H7BrF2N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H7BrF2N4S |
|---|---|
| Molecular Weight | 393.2 |
| InChIKey | YEVANGIPBHAZIA-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2nn3c(-c4ccccc4F)nnc3s2)cc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole? |
| A: SMILES notation of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole is Fc1ccc(-c2nn3c(-c4ccccc4F)nnc3s2)cc1Br. |
| Q: What is the InChIKey of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole? |
| A: InChIKey of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole is YEVANGIPBHAZIA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole? |
| A: Molecular formula of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole is C15H7BrF2N4S. |
| Q: What is the English name of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole? |
| A: The English name of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole is 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole. |
| Q: What is the Chinese name of 951949-15-8? |
| A: Chinese name of 951949-15-8 is 951949-15-8. |
| Q: What is the molecular weight of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole? |
| A: Molecular weight of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole is 393.2. |
| Q: What is the CAS number of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole? |
| A: CAS number of 6-(3-Bromo-4-fluorophenyl)-3-(2-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole is 951949-15-8. |