N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide
Modify Date: 2026-07-18 19:43:22
![N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide Structure](https://www.chemsrc.com/extcaspic/064/951972-31-9.png)
N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide structure
|
Common Name | N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 951972-31-9 | Molecular Weight | 404.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H24N4O3 |
|---|---|
| Molecular Weight | 404.5 |
| InChIKey | WDDFTFHHYHFQGU-UHFFFAOYSA-N |
| SMILES | COc1cccc2[nH]c(C(=O)NCCC(=O)NCCc3c[nH]c4ccccc34)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide? |
| A: The English name of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide is N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide. |
| Q: What is the Chinese name of 951972-31-9? |
| A: Chinese name of 951972-31-9 is 951972-31-9. |
| Q: What is the SMILES notation of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide? |
| A: SMILES notation of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide is COc1cccc2[nH]c(C(=O)NCCC(=O)NCCc3c[nH]c4ccccc34)cc12. |
| Q: What is the molecular weight of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide? |
| A: Molecular weight of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide is 404.5. |
| Q: What is the CAS number of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide? |
| A: CAS number of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide is 951972-31-9. |
| Q: What is the molecular formula of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide? |
| A: Molecular formula of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide is C23H24N4O3. |
| Q: What is the InChIKey of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide? |
| A: InChIKey of N-(3-{[2-(1H-indol-3-yl)ethyl]amino}-3-oxopropyl)-4-methoxy-1H-indole-2-carboxamide is WDDFTFHHYHFQGU-UHFFFAOYSA-N. |