Butyric acid, 4-hydroxy-2-nicotinamido
Modify Date: 2026-07-17 19:13:36
Butyric acid, 4-hydroxy-2-nicotinamido structure
|
Common Name | Butyric acid, 4-hydroxy-2-nicotinamido | ||
|---|---|---|---|---|
| CAS Number | 952-48-7 | Molecular Weight | 224.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Butyric acid, 4-hydroxy-2-nicotinamido |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12N2O4 |
|---|---|
| Molecular Weight | 224.21 |
| InChIKey | XDPNQILUEZANOG-UHFFFAOYSA-N |
| SMILES | O=C(NC(CCO)C(=O)O)c1cccnc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Butyric acid, 4-hydroxy-2-nicotinamido? |
| A: Molecular formula of Butyric acid, 4-hydroxy-2-nicotinamido is C10H12N2O4. |
| Q: What is the English name of Butyric acid, 4-hydroxy-2-nicotinamido? |
| A: The English name of Butyric acid, 4-hydroxy-2-nicotinamido is Butyric acid, 4-hydroxy-2-nicotinamido. |
| Q: What is the InChIKey of Butyric acid, 4-hydroxy-2-nicotinamido? |
| A: InChIKey of Butyric acid, 4-hydroxy-2-nicotinamido is XDPNQILUEZANOG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Butyric acid, 4-hydroxy-2-nicotinamido? |
| A: SMILES notation of Butyric acid, 4-hydroxy-2-nicotinamido is O=C(NC(CCO)C(=O)O)c1cccnc1. |
| Q: What is the CAS number of Butyric acid, 4-hydroxy-2-nicotinamido? |
| A: CAS number of Butyric acid, 4-hydroxy-2-nicotinamido is 952-48-7. |
| Q: What is the molecular weight of Butyric acid, 4-hydroxy-2-nicotinamido? |
| A: Molecular weight of Butyric acid, 4-hydroxy-2-nicotinamido is 224.21. |
| Q: What is the Chinese name of 952-48-7? |
| A: Chinese name of 952-48-7 is 952-48-7. |