3-Pyridinecarboxamide,1,4-dihydro-1-(phenylmethyl) structure
|
Common Name | 3-Pyridinecarboxamide,1,4-dihydro-1-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 952-92-1 | Molecular Weight | 214.26300 | |
| Density | 1.198g/cm3 | Boiling Point | 433.4ºC at 760mmHg | |
| Molecular Formula | C13H14N2O | Melting Point | 121ºC | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | 1-benzyl-4H-pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 433.4ºC at 760mmHg |
| Melting Point | 121ºC |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26300 |
| Flash Point | 215.9ºC |
| Exact Mass | 214.11100 |
| PSA | 46.33000 |
| LogP | 2.41340 |
| Index of Refraction | 1.623 |
| InChIKey | CMNUYDSETOTBDE-UHFFFAOYSA-N |
| SMILES | NC(=O)C1=CN(Cc2ccccc2)C=CC1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Inhibition of muscarinic receptor mediated [Ca2+] dependent contraction of guinea pig...
Source: ChEMBL
Target: Muscarinic acetylcholine receptor M4
External Id: CHEMBL688119
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: Inhibition of Dengue virus type 2 NS5 RNA methyltransferase SAM site
Source: ChEMBL
Target: Genome polyprotein
External Id: CHEMBL1067225
|
|
Name: Inhibition of Dengue virus type 2 NS5 RNA methyltransferase SAM site with 0.1 % TX100
Source: ChEMBL
Target: Genome polyprotein
External Id: CHEMBL1067224
|
|
Name: Calcium channel antagonistic activity relative to 2,6-Dimethyl-4-(2-nitro-phenyl)-1,4...
Source: ChEMBL
Target: Voltage-dependent L-type calcium channel subunit alpha-1C
External Id: CHEMBL839727
|
| N-benzyl-1,4-dihydronicotineamide |
| 1,4-Dihydro-N-1-benzylnicotinamide |
| 1-Benzyl-1,4-dihydronicotinamide |
| Benzyldihydronicotinamide |
| N-Benzyldihydronicotinamide |
| 1-benzyl-3-carbamoyl-1,4-dihydropyridine |
| N-Benzyl-1,4-dihydronicotinamide |