1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone
Modify Date: 2026-08-15 19:24:18
![1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone Structure](https://www.chemsrc.com/extcaspic/421/952000-45-2.png)
1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone structure
|
Common Name | 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone | ||
|---|---|---|---|---|
| CAS Number | 952000-45-2 | Molecular Weight | 423.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H25N3O5 |
|---|---|
| Molecular Weight | 423.5 |
| InChIKey | SKXHSRURLMLZEF-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3cc4ccccc4[nH]3)CC2)cc(OC)c1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone? |
| A: CAS number of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone is 952000-45-2. |
| Q: What is the English name of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone? |
| A: The English name of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone is 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone. |
| Q: What is the molecular weight of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone? |
| A: Molecular weight of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone is 423.5. |
| Q: What is the molecular formula of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone? |
| A: Molecular formula of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone is C23H25N3O5. |
| Q: What is the SMILES notation of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone? |
| A: SMILES notation of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone is COc1cc(C(=O)N2CCN(C(=O)c3cc4ccccc4[nH]3)CC2)cc(OC)c1OC. |
| Q: What is the Chinese name of 952000-45-2? |
| A: Chinese name of 952000-45-2 is 952000-45-2. |
| Q: What is the InChIKey of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone? |
| A: InChIKey of 1H-indol-2-yl{4-[(3,4,5-trimethoxyphenyl)carbonyl]piperazin-1-yl}methanone is SKXHSRURLMLZEF-UHFFFAOYSA-N. |