2-azido-1-(1-methylindol-3-yl)ethanone structure
|
Common Name | 2-azido-1-(1-methylindol-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 95202-72-5 | Molecular Weight | 214.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-azido-1-(1-methylindol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N4O |
|---|---|
| Molecular Weight | 214.22300 |
| Exact Mass | 214.08500 |
| PSA | 71.75000 |
| LogP | 2.12406 |
| InChIKey | SLCWCYQPTDSZSE-UHFFFAOYSA-N |
| SMILES | Cn1cc(C(=O)CN=[N+]=[N-])c2ccccc21 |
|
~%
2-azido-1-(1-me... CAS#:95202-72-5 |
| Literature: Moody, Christopher J.; Ward, John G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 12 p. 2903 - 2909 |
|
~%
2-azido-1-(1-me... CAS#:95202-72-5 |
| Literature: Moody, Christopher J.; Ward, John G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 12 p. 2903 - 2909 |
| 3-azidoacetyl-1-methylindole |
| Ethanone,2-azido-1-(1-methyl-1H-indol-3-yl) |