2-azido-1-(1-methylindol-3-yl)ethanone
2-azido-1-(1-methylindol-3-yl)ethanone structure
|
Common Name | 2-azido-1-(1-methylindol-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 95202-72-5 | Molecular Weight | 214.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-azido-1-(1-methylindol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10N4O |
|---|---|
| Molecular Weight | 214.22300 |
| Exact Mass | 214.08500 |
| PSA | 71.75000 |
| LogP | 2.12406 |
| InChIKey | SLCWCYQPTDSZSE-UHFFFAOYSA-N |
| SMILES | Cn1cc(C(=O)CN=[N+]=[N-])c2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-azido-1-(1-me... CAS#:95202-72-5 |
| Literature: Moody, Christopher J.; Ward, John G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 12 p. 2903 - 2909 |
|
~%
2-azido-1-(1-me... CAS#:95202-72-5 |
| Literature: Moody, Christopher J.; Ward, John G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 12 p. 2903 - 2909 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-azidoacetyl-1-methylindole |
| Ethanone,2-azido-1-(1-methyl-1H-indol-3-yl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-azido-1-(1-methylindol-3-yl)ethanone? |
| A: Molecular formula of 2-azido-1-(1-methylindol-3-yl)ethanone is C11H10N4O. |
| Q: What is the SMILES notation of 2-azido-1-(1-methylindol-3-yl)ethanone? |
| A: SMILES notation of 2-azido-1-(1-methylindol-3-yl)ethanone is Cn1cc(C(=O)CN=[N+]=[N-])c2ccccc21. |
| Q: What is the CAS number of 2-azido-1-(1-methylindol-3-yl)ethanone? |
| A: CAS number of 2-azido-1-(1-methylindol-3-yl)ethanone is 95202-72-5. |
| Q: What is the InChIKey of 2-azido-1-(1-methylindol-3-yl)ethanone? |
| A: InChIKey of 2-azido-1-(1-methylindol-3-yl)ethanone is SLCWCYQPTDSZSE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 95202-72-5? |
| A: Chinese name of 95202-72-5 is 95202-72-5. |
| Q: What is the polar surface area (PSA) of 2-azido-1-(1-methylindol-3-yl)ethanone? |
| A: Polar surface area (PSA) of 2-azido-1-(1-methylindol-3-yl)ethanone is 71.75000. |
| Q: What English synonyms does 2-azido-1-(1-methylindol-3-yl)ethanone have? |
| A: English synonyms of 2-azido-1-(1-methylindol-3-yl)ethanone: 3-azidoacetyl-1-methylindole, Ethanone,2-azido-1-(1-methyl-1H-indol-3-yl). |
| Q: What is the English name of 2-azido-1-(1-methylindol-3-yl)ethanone? |
| A: The English name of 2-azido-1-(1-methylindol-3-yl)ethanone is 2-azido-1-(1-methylindol-3-yl)ethanone. |
| Q: What is the LogP of 2-azido-1-(1-methylindol-3-yl)ethanone? |
| A: LogP of 2-azido-1-(1-methylindol-3-yl)ethanone is 2.12406. |
| Q: What is the molecular weight of 2-azido-1-(1-methylindol-3-yl)ethanone? |
| A: Molecular weight of 2-azido-1-(1-methylindol-3-yl)ethanone is 214.22300. |