Parishin E structure
|
Common Name | Parishin E | ||
|---|---|---|---|---|
| CAS Number | 952068-57-4 | Molecular Weight | 460.386 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 784.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H24O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.8±26.4 °C | |
Use of Parishin EParishin E, a parishin derivative isolated from Gastrodia elata, may have antioxidant property[1]. |
| Name | β-D-Glucopyranoside, 4-[(3,4-dicarboxy-3-hydroxy-1-oxobutoxy)methyl]phenyl |
|---|---|
| Synonym | More Synonyms |
| Description | Parishin E, a parishin derivative isolated from Gastrodia elata, may have antioxidant property[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 784.1±60.0 °C at 760 mmHg |
| Molecular Formula | C19H24O13 |
| Molecular Weight | 460.386 |
| Flash Point | 274.8±26.4 °C |
| Exact Mass | 460.121704 |
| PSA | 220.51000 |
| LogP | -1.57 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | XAIUTKHLNZBMEG-HUNOYVTQSA-N |
| SMILES | O=C(O)CC(O)(CC(=O)OCc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1)C(=O)O |
| 2-(2-{[4-(β-D-Glucopyranosyloxy)benzyl]oxy}-2-oxoethyl)-2-hydroxysuccinic acid |
| Parishin E |
| 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, 1-[[4-(β-D-glucopyranosyloxy)phenyl]methyl] ester |