N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine
N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine structure
|
Common Name | N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 95237-16-4 | Molecular Weight | 315.45300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H29N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H29N3O |
|---|---|
| Molecular Weight | 315.45300 |
| Exact Mass | 315.23100 |
| PSA | 46.18000 |
| LogP | 4.59750 |
| InChIKey | CPGAASLSRQHUHN-UHFFFAOYSA-N |
| SMILES | CCNCCCCCCNc1cc(OC)cc2c(C)ccnc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-ethyl-N'-(6-m... CAS#:95237-16-4 |
| Literature: Campbell et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 1465 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Desethyl-Sitamaquine |
| N-Aethyl-N'-(6-methoxy-4-methyl-[8]chinolyl)-hexandiyldiamin |
| N-ethyl-N'-(6-methoxy-4-methyl-[8]quinolyl)-hexanediyldiamine |
| 1,6-Hexanediamine,N-ethyl-N'-(6-methoxy-4-methyl-8-quinolinyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine? |
| A: The English name of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine is N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine. |
| Q: What is the LogP of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine? |
| A: LogP of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine is 4.59750. |
| Q: What is the polar surface area (PSA) of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine? |
| A: Polar surface area (PSA) of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine is 46.18000. |
| Q: What English synonyms does N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine have? |
| A: English synonyms of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine: Desethyl-Sitamaquine, N-Aethyl-N'-(6-methoxy-4-methyl-[8]chinolyl)-hexandiyldiamin, N-ethyl-N'-(6-methoxy-4-methyl-[8]quinolyl)-hexanediyldiamine, 1,6-Hexanediamine,N-ethyl-N'-(6-methoxy-4-methyl-8-quinolinyl). |
| Q: What is the molecular formula of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine? |
| A: Molecular formula of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine is C19H29N3O. |
| Q: What is the molecular weight of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine? |
| A: Molecular weight of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine is 315.45300. |
| Q: What is the InChIKey of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine? |
| A: InChIKey of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine is CPGAASLSRQHUHN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 95237-16-4? |
| A: Chinese name of 95237-16-4 is 95237-16-4. |
| Q: What is the SMILES notation of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine? |
| A: SMILES notation of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine is CCNCCCCCCNc1cc(OC)cc2c(C)ccnc12. |
| Q: What is the CAS number of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine? |
| A: CAS number of N-ethyl-N'-(6-methoxy-4-methylquinolin-8-yl)hexane-1,6-diamine is 95237-16-4. |