Deoxy-V-Trypt E
Modify Date: 2026-07-26 21:48:30
Deoxy-V-Trypt E structure
|
Common Name | Deoxy-V-Trypt E | ||
|---|---|---|---|---|
| CAS Number | 95273-83-9 | Molecular Weight | 953.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C56H68N6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Deoxy-V-Trypt E |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C56H68N6O8 |
|---|---|
| Molecular Weight | 953.2 |
| InChIKey | GUZHKWGJIUQTGH-CDBVHANDSA-N |
| SMILES | CCOC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1(O)C(O)C2(CC)C=CCN3CCC4(c5cc(C6(C(=O)OC)CC7CC(CC)CN(CCc8c6[nH]c6ccccc86)C7)c(OC)cc5N(C)C14)C32 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Deoxy-V-Trypt E? |
| A: SMILES notation of Deoxy-V-Trypt E is CCOC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1(O)C(O)C2(CC)C=CCN3CCC4(c5cc(C6(C(=O)OC)CC7CC(CC)CN(CCc8c6[nH]c6ccccc86)C7)c(OC)cc5N(C)C14)C32. |
| Q: What is the Chinese name of 95273-83-9? |
| A: Chinese name of 95273-83-9 is 95273-83-9. |
| Q: What is the molecular formula of Deoxy-V-Trypt E? |
| A: Molecular formula of Deoxy-V-Trypt E is C56H68N6O8. |
| Q: What is the English name of Deoxy-V-Trypt E? |
| A: The English name of Deoxy-V-Trypt E is Deoxy-V-Trypt E. |
| Q: What is the InChIKey of Deoxy-V-Trypt E? |
| A: InChIKey of Deoxy-V-Trypt E is GUZHKWGJIUQTGH-CDBVHANDSA-N. |
| Q: What is the molecular weight of Deoxy-V-Trypt E? |
| A: Molecular weight of Deoxy-V-Trypt E is 953.2. |
| Q: What is the CAS number of Deoxy-V-Trypt E? |
| A: CAS number of Deoxy-V-Trypt E is 95273-83-9. |