N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide structure
|
Common Name | N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 952984-91-7 | Molecular Weight | 409.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H23N3O2 |
|---|---|
| Molecular Weight | 409.5 |
| InChIKey | POTGYTSZAOSZHE-UHFFFAOYSA-N |
| SMILES | O=C(CCCn1nc(-c2ccccc2)ccc1=O)Nc1ccccc1-c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide? |
| A: InChIKey of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide is POTGYTSZAOSZHE-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide? |
| A: CAS number of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide is 952984-91-7. |
| Q: What is the SMILES notation of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide? |
| A: SMILES notation of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide is O=C(CCCn1nc(-c2ccccc2)ccc1=O)Nc1ccccc1-c1ccccc1. |
| Q: What is the Chinese name of 952984-91-7? |
| A: Chinese name of 952984-91-7 is 952984-91-7. |
| Q: What is the molecular formula of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide? |
| A: Molecular formula of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide is C26H23N3O2. |
| Q: What is the English name of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide? |
| A: The English name of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide is N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide. |
| Q: What is the molecular weight of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide? |
| A: Molecular weight of N-([1,1'-biphenyl]-2-yl)-4-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide is 409.5. |