Ethyl (4-(2-oxo-2-(o-tolylamino)ethyl)thiazol-2-yl)carbamate
Modify Date: 2025-08-28 12:12:42
Ethyl (4-(2-oxo-2-(o-tolylamino)ethyl)thiazol-2-yl)carbamate structure
|
Common Name | Ethyl (4-(2-oxo-2-(o-tolylamino)ethyl)thiazol-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 953136-60-2 | Molecular Weight | 319.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl (4-(2-oxo-2-(o-tolylamino)ethyl)thiazol-2-yl)carbamate |
|---|
| Molecular Formula | C15H17N3O3S |
|---|---|
| Molecular Weight | 319.4 |
| InChIKey | BQEPHPIPWOUSPY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1nc(CC(=O)Nc2ccccc2C)cs1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1