Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate
Modify Date: 2026-06-30 20:07:01
Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate structure
|
Common Name | Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate | ||
|---|---|---|---|---|
| CAS Number | 953181-03-8 | Molecular Weight | 399.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H25N3O5 |
|---|---|
| Molecular Weight | 399.4 |
| InChIKey | WBZVCMBAGLDWNN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NC(=O)C(=O)NCC2CCN(Cc3ccco3)CC2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate? |
| A: CAS number of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate is 953181-03-8. |
| Q: What is the English name of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate? |
| A: The English name of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate is Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate. |
| Q: What is the Chinese name of 953181-03-8? |
| A: Chinese name of 953181-03-8 is 953181-03-8. |
| Q: What is the InChIKey of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate? |
| A: InChIKey of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate is WBZVCMBAGLDWNN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate? |
| A: Molecular weight of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate is 399.4. |
| Q: What is the molecular formula of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate? |
| A: Molecular formula of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate is C21H25N3O5. |
| Q: What is the SMILES notation of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate? |
| A: SMILES notation of Methyl 4-(2-(((1-(furan-2-ylmethyl)piperidin-4-yl)methyl)amino)-2-oxoacetamido)benzoate is COC(=O)c1ccc(NC(=O)C(=O)NCC2CCN(Cc3ccco3)CC2)cc1. |