N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide
Modify Date: 2026-07-22 20:55:46
![N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide Structure](https://www.chemsrc.com/extcaspic/437/953181-37-8.png)
N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide structure
|
Common Name | N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 953181-37-8 | Molecular Weight | 356.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H17FN2O4 |
|---|---|
| Molecular Weight | 356.3 |
| InChIKey | CREHARMNSZIZDU-UHFFFAOYSA-N |
| SMILES | COc1cccc(OCC(=O)NCc2cc(-c3ccc(F)cc3)on2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide? |
| A: Molecular weight of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide is 356.3. |
| Q: What is the English name of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide? |
| A: The English name of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide is N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide. |
| Q: What is the molecular formula of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide? |
| A: Molecular formula of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide is C19H17FN2O4. |
| Q: What is the CAS number of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide? |
| A: CAS number of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide is 953181-37-8. |
| Q: What is the InChIKey of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide? |
| A: InChIKey of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide is CREHARMNSZIZDU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 953181-37-8? |
| A: Chinese name of 953181-37-8 is 953181-37-8. |
| Q: What is the SMILES notation of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide? |
| A: SMILES notation of N-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl}-2-(3-methoxyphenoxy)acetamide is COc1cccc(OCC(=O)NCc2cc(-c3ccc(F)cc3)on2)c1. |