2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate
Modify Date: 2026-07-06 09:50:48
![2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate Structure](https://www.chemsrc.com/extcaspic/173/953221-54-0.png)
2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate structure
|
Common Name | 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate | ||
|---|---|---|---|---|
| CAS Number | 953221-54-0 | Molecular Weight | 446.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20BrN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20BrN3O2S |
|---|---|
| Molecular Weight | 446.4 |
| InChIKey | CGXITILXQDYNHD-UHFFFAOYSA-N |
| SMILES | CCN1CCN(c2nc3ccc(OC(=O)c4ccccc4Br)cc3s2)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate? |
| A: Molecular weight of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate is 446.4. |
| Q: What is the molecular formula of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate? |
| A: Molecular formula of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate is C20H20BrN3O2S. |
| Q: What is the SMILES notation of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate? |
| A: SMILES notation of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate is CCN1CCN(c2nc3ccc(OC(=O)c4ccccc4Br)cc3s2)CC1. |
| Q: What is the Chinese name of 953221-54-0? |
| A: Chinese name of 953221-54-0 is 953221-54-0. |
| Q: What is the CAS number of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate? |
| A: CAS number of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate is 953221-54-0. |
| Q: What is the English name of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate? |
| A: The English name of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate is 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate. |
| Q: What is the InChIKey of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate? |
| A: InChIKey of 2-(4-Ethylpiperazin-1-yl)benzo[d]thiazol-6-yl 2-bromobenzoate is CGXITILXQDYNHD-UHFFFAOYSA-N. |