N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide
Modify Date: 2025-09-04 07:42:52
N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide structure
|
Common Name | N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 953255-68-0 | Molecular Weight | 352.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20N2O4 |
|---|---|
| Molecular Weight | 352.4 |
| InChIKey | XJJQNECMCWFWEP-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(CC(=O)NCc3cccc(OC)c3)no2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide? |
| A: CAS number of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide is 953255-68-0. |
| Q: What is the SMILES notation of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide? |
| A: SMILES notation of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide is COc1ccc(-c2cc(CC(=O)NCc3cccc(OC)c3)no2)cc1. |
| Q: What is the molecular formula of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide? |
| A: Molecular formula of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide is C20H20N2O4. |
| Q: What is the English name of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide? |
| A: The English name of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide is N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide. |
| Q: What is the InChIKey of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide? |
| A: InChIKey of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide is XJJQNECMCWFWEP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide? |
| A: Molecular weight of N-(3-methoxybenzyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)acetamide is 352.4. |
| Q: What is the Chinese name of 953255-68-0? |
| A: Chinese name of 953255-68-0 is 953255-68-0. |