4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione
Modify Date: 2026-08-31 13:18:55
4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione structure
|
Common Name | 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 954124-95-9 | Molecular Weight | 298.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H22N2O2 |
|---|---|
| Molecular Weight | 298.4 |
| InChIKey | ASYVLSHERFOFMG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(c2ccc(N)c(C3=CCCCC3)c2)CC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione? |
| A: Molecular weight of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione is 298.4. |
| Q: What is the SMILES notation of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione? |
| A: SMILES notation of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione is CN1C(=O)CC(c2ccc(N)c(C3=CCCCC3)c2)CC1=O. |
| Q: What is the CAS number of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione? |
| A: CAS number of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione is 954124-95-9. |
| Q: What is the Chinese name of 954124-95-9? |
| A: Chinese name of 954124-95-9 is 954124-95-9. |
| Q: What is the English name of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione? |
| A: The English name of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione is 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione. |
| Q: What is the molecular formula of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione? |
| A: Molecular formula of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione is C18H22N2O2. |
| Q: What is the InChIKey of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione? |
| A: InChIKey of 4-(4-Amino-3-cyclohex-1-enyl-phenyl)-1-methyl-piperidine-2,6-dione is ASYVLSHERFOFMG-UHFFFAOYSA-N. |