(E)-3-(2-phenoxyphenyl)acrylic acid
(E)-3-(2-phenoxyphenyl)acrylic acid structure
|
Common Name | (E)-3-(2-phenoxyphenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 95433-16-2 | Molecular Weight | 240.25400 | |
| Density | 1.228g/cm3 | Boiling Point | 387.9ºC at 760mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | 182-184ºC | |
| MSDS | N/A | Flash Point | 145.8ºC | |
Summary: 3-(2-Phenoxyphenyl)acrylic acid (common name: (E)-3-(2-phenoxyphenyl)acrylic acid) is a chemical substance with CAS number 95433-16-2, molecular formula C15H12O3, and molecular weight 240.25400. Its melting point is 182-184ºC and boiling point is 387.9ºC. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Phenoxyphenyl)acrylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 387.9ºC at 760mmHg |
| Melting Point | 182-184ºC |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 145.8ºC |
| Exact Mass | 240.07900 |
| PSA | 46.53000 |
| LogP | 3.57670 |
| Index of Refraction | 1.636 |
| InChIKey | SDXHWGNPWXDXTC-ZHACJKMWSA-N |
| SMILES | O=C(O)C=Cc1ccccc1Oc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(E)-3-(2-phenox... CAS#:95433-16-2 |
| Literature: Journal of the American Chemical Society, , vol. 72, p. 4797 |
|
~%
(E)-3-(2-phenox... CAS#:95433-16-2 |
| Literature: Journal of the American Chemical Society, , vol. 72, p. 4797 |
|
~%
(E)-3-(2-phenox... CAS#:95433-16-2 |
| Literature: Journal of the American Chemical Society, , vol. 72, p. 4797 |
|
~%
(E)-3-(2-phenox... CAS#:95433-16-2 |
| Literature: Journal of the American Chemical Society, , vol. 72, p. 4797 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-phenoxy-trans-cinnamic acid |
| (E)-3-(2-PHENOXYPHENYL)-2-PROPENOIC ACID |
| RARECHEM AL BK 1507 |
| 2-Phenoxy-trans-zimtsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: Molecular formula of 3-(2-Phenoxyphenyl)acrylic acid is C15H12O3. |
| Q: What is the melting point of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: Melting point of 3-(2-Phenoxyphenyl)acrylic acid is 182-184ºC. |
| Q: What is the polar surface area (PSA) of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: Polar surface area (PSA) of 3-(2-Phenoxyphenyl)acrylic acid is 46.53000. |
| Q: What is the LogP of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: LogP of 3-(2-Phenoxyphenyl)acrylic acid is 3.57670. |
| Q: What is the molecular weight of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: Molecular weight of 3-(2-Phenoxyphenyl)acrylic acid is 240.25400. |
| Q: What is the English name of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: The English name of 3-(2-Phenoxyphenyl)acrylic acid is 3-(2-Phenoxyphenyl)acrylic acid. |
| Q: What is the InChIKey of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: InChIKey of 3-(2-Phenoxyphenyl)acrylic acid is SDXHWGNPWXDXTC-ZHACJKMWSA-N. |
| Q: What is the CAS number of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: CAS number of 3-(2-Phenoxyphenyl)acrylic acid is 95433-16-2. |
| Q: What is the SMILES notation of 3-(2-Phenoxyphenyl)acrylic acid? |
| A: SMILES notation of 3-(2-Phenoxyphenyl)acrylic acid is O=C(O)C=Cc1ccccc1Oc1ccccc1. |
| Q: What English synonyms does 3-(2-Phenoxyphenyl)acrylic acid have? |
| A: English synonyms of 3-(2-Phenoxyphenyl)acrylic acid: 2-phenoxy-trans-cinnamic acid, (E)-3-(2-PHENOXYPHENYL)-2-PROPENOIC ACID, RARECHEM AL BK 1507, 2-Phenoxy-trans-zimtsaeure. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |