7-bromo-1-methyl-2-nitrobenzo[e][1]benzofuran structure
|
Common Name | 7-bromo-1-methyl-2-nitrobenzo[e][1]benzofuran | ||
|---|---|---|---|---|
| CAS Number | 95454-95-8 | Molecular Weight | 306.11200 | |
| Density | 1.656g/cm3 | Boiling Point | 446.6ºC at 760 mmHg | |
| Molecular Formula | C13H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9ºC | |
| Name | 7-bromo-1-methyl-2-nitrobenzo[e][1]benzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.656g/cm3 |
|---|---|
| Boiling Point | 446.6ºC at 760 mmHg |
| Molecular Formula | C13H8BrNO3 |
| Molecular Weight | 306.11200 |
| Flash Point | 223.9ºC |
| Exact Mass | 304.96900 |
| PSA | 58.96000 |
| LogP | 5.08830 |
| Index of Refraction | 1.724 |
| InChIKey | JUTVQFUCVFGEPL-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])oc2ccc3cc(Br)ccc3c12 |
|
~%
7-bromo-1-methy... CAS#:95454-95-8 |
| Literature: Einhorn; Demerseman; Royer; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 5 p. 405 - 410 |
|
~14%
7-bromo-1-methy... CAS#:95454-95-8 |
| Literature: Einhorn; Demerseman; Royer; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 5 p. 405 - 410 |
| R 7470 |
| 1-Methyl-2-nitro-7-bromonaphtho(2,1-b)furan |
| 7-Bromo-1-methyl-2-nitronaphtho(2,1-b)furan |
| NAPHTHO(2,1-b)FURAN,7-BROMO-1-METHYL-2-NITRO |
| bromo-7 methyl-1 nitro-2 naphto<2,1-b>furanne |