5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide
Modify Date: 2026-07-18 13:23:12
5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide structure
|
Common Name | 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 954792-72-4 | Molecular Weight | 284.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20N4O |
|---|---|
| Molecular Weight | 284.36 |
| InChIKey | ZEFMDHKCYVZKKD-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)c1nnn(-c2ccc(C)cc2)c1C1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: Molecular formula of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide is C16H20N4O. |
| Q: What is the English name of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: The English name of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide is 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide. |
| Q: What is the InChIKey of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: InChIKey of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide is ZEFMDHKCYVZKKD-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: SMILES notation of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide is CCCNC(=O)c1nnn(-c2ccc(C)cc2)c1C1CC1. |
| Q: What is the Chinese name of 954792-72-4? |
| A: Chinese name of 954792-72-4 is 954792-72-4. |
| Q: What is the CAS number of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: CAS number of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide is 954792-72-4. |
| Q: What is the molecular weight of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: Molecular weight of 5-cyclopropyl-1-(4-methylphenyl)-N-propyl-1H-1,2,3-triazole-4-carboxamide is 284.36. |