2-(5-cyclopropyl-1-(p-tolyl)-1H-1,2,3-triazol-4-yl)-5-phenyl-1,3,4-oxadiazole structure
|
Common Name | 2-(5-cyclopropyl-1-(p-tolyl)-1H-1,2,3-triazol-4-yl)-5-phenyl-1,3,4-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 954792-78-0 | Molecular Weight | 343.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-cyclopropyl-1-(p-tolyl)-1H-1,2,3-triazol-4-yl)-5-phenyl-1,3,4-oxadiazole |
|---|
| Molecular Formula | C20H17N5O |
|---|---|
| Molecular Weight | 343.4 |
| InChIKey | LJABWEUJHOARBV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2nnc(-c3nnc(-c4ccccc4)o3)c2C2CC2)cc1 |
|
Name: Inhibition of human dCTPase 1 at 10 uM relative to control
Source: ChEMBL
Target: dCTP pyrophosphatase 1
External Id: CHEMBL4057014
|
|
Name: Inhibition of human dCTPase 1
Source: ChEMBL
Target: dCTP pyrophosphatase 1
External Id: CHEMBL4057013
|