Benzeneacetic acid,-alpha-,-alpha--dimethyl-4-(2-methylpropyl)- (9CI) structure
|
Common Name | Benzeneacetic acid,-alpha-,-alpha--dimethyl-4-(2-methylpropyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 95499-72-2 | Molecular Weight | 220.30700 | |
| Density | 1.015g/cm3 | Boiling Point | 328.3ºC at 760mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4ºC | |
| Name | 2-methyl-2-[4-(2-methylpropyl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.015g/cm3 |
|---|---|
| Boiling Point | 328.3ºC at 760mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 225.4ºC |
| Exact Mass | 220.14600 |
| PSA | 37.30000 |
| LogP | 3.24730 |
| Index of Refraction | 1.51 |
| InChIKey | AZPUUNIFABPZND-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1ccc(C(C)(C)C(=O)O)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(4-isobutylphenyl)-2-methylpropanoic acid |
| 2-methyl-2-(p-isobutylphenyl)propionic acid |
| 2-(4-isobutyl-phenyl)-2-methyl propionic acid |
| methylibuprofen |