4-butoxy-3-chloro-5-methoxybenzoic acid
Modify Date: 2025-10-28 14:21:52
4-butoxy-3-chloro-5-methoxybenzoic acid structure
|
Common Name | 4-butoxy-3-chloro-5-methoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 955-36-2 | Molecular Weight | 258.69800 | |
| Density | N/A | Boiling Point | 367.7ºC at 760mmHg | |
| Molecular Formula | C12H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-butoxy-3-chloro-5-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 367.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.69800 |
| Exact Mass | 258.06600 |
| PSA | 55.76000 |
| LogP | 3.22570 |
| InChIKey | GEFFQWTVLBEQKZ-UHFFFAOYSA-N |
| SMILES | CCCCOc1c(Cl)cc(C(=O)O)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Chlor-4-butyloxy-3-methoxy-benzoesaeure |
| 3-Methoxy-4-butoxy-5-chlor-benzoesaeure |