tert-butyl N-(5-chloro-2-methylsulfonylpyrimidin-4-yl)carbamate structure
|
Common Name | tert-butyl N-(5-chloro-2-methylsulfonylpyrimidin-4-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 955112-59-1 | Molecular Weight | 307.75400 | |
| Density | 1.408g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14ClN3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-(5-chloro-2-methylsulfonylpyrimidin-4-yl)carbamate |
|---|
| Density | 1.408g/cm3 |
|---|---|
| Molecular Formula | C10H14ClN3O4S |
| Molecular Weight | 307.75400 |
| Exact Mass | 307.03900 |
| PSA | 110.12000 |
| LogP | 2.97490 |
| Index of Refraction | 1.547 |
| InChIKey | BRQMVVSECBWDCA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1nc(S(C)(=O)=O)ncc1Cl |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |