Ethyl 3-(3-((1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl)methyl)ureido)propanoate structure
|
Common Name | Ethyl 3-(3-((1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl)methyl)ureido)propanoate | ||
|---|---|---|---|---|
| CAS Number | 955237-82-8 | Molecular Weight | 367.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-(3-((1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl)methyl)ureido)propanoate |
|---|
| Molecular Formula | C17H22ClN3O4 |
|---|---|
| Molecular Weight | 367.8 |
| InChIKey | SHKYCZVRZXKWQP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCNC(=O)NCC1CC(=O)N(c2ccc(Cl)cc2)C1 |
|
Name: WHO-TDR: Human African Trypanosomiasis (HAT)
Source: ChEMBL
Target: Trypanosoma brucei brucei
External Id: CHEMBL2093839
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: WHO-TDR: Schistosomiasis
Source: ChEMBL
Target: Schistosoma mansoni
External Id: CHEMBL2093841
|