(S)-tert-Butyl 3-(methoxymethyl)piperazine-1-carboxylate structure
|
Common Name | (S)-tert-Butyl 3-(methoxymethyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 955400-16-5 | Molecular Weight | 230.304 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 300.9±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.8±20.9 °C | |
| Name | 1-Piperazinecarboxylic acid, 3-(methoxymethyl)-, 1,1-dimethylethyl ester, (3S) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.9±17.0 °C at 760 mmHg |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.304 |
| Flash Point | 135.8±20.9 °C |
| Exact Mass | 230.163040 |
| PSA | 50.80000 |
| LogP | 0.45 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | QBJWNCXOPXVECA-VIFPVBQESA-N |
| SMILES | COCC1CN(C(=O)OC(C)(C)C)CCN1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (S)-1-Boc-3-(methoxymethyl)piperazine |
| 1-Piperazinecarboxylic acid, 2-(methoxymethyl)-, 1,1-dimethylethyl ester, (2S)- |
| (S)-tert-butyl 2-(MethoxyMethyl)piperazine-1-carboxylate |
| 2-Methyl-2-propanyl (2S)-2-(methoxymethyl)-1-piperazinecarboxylate |