tert-butyl N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]carbamate structure
|
Common Name | tert-butyl N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 956018-34-1 | Molecular Weight | 243.32600 | |
| Density | 1.203g/cm3 | Boiling Point | 419.7ºC at 760 mmHg | |
| Molecular Formula | C10H17N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | tert-butyl N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 419.7ºC at 760 mmHg |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.32600 |
| Flash Point | 207.6ºC |
| Exact Mass | 243.10400 |
| PSA | 105.48000 |
| LogP | 2.76460 |
| Index of Refraction | 1.556 |
| InChIKey | IIILZIJRVHFCGL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCc1csc(N)n1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| tert-butyl 2-(2-aminothiazol-4-yl)ethylcarbamate |
| ar2366 |