hernandulcin structure
|
Common Name | hernandulcin | ||
|---|---|---|---|---|
| CAS Number | 95602-94-1 | Molecular Weight | 236.35000 | |
| Density | 0.995g/cm3 | Boiling Point | 368.9ºC at 760mmHg | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.4ºC | |
| Name | (6S)-6-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-3-methylcyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 368.9ºC at 760mmHg |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35000 |
| Flash Point | 157.4ºC |
| Exact Mass | 236.17800 |
| PSA | 37.30000 |
| LogP | 3.40920 |
| Index of Refraction | 1.503 |
| InChIKey | HYQNKKAJVPMBDR-HIFRSBDPSA-N |
| SMILES | CC(C)=CCCC(C)(O)C1CCC(C)=CC1=O |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-Cyclohexen-1-one,6-(1-hydroxy-1,5-dimethyl-4-hexenyl)-3-methyl-,(S-(R*,R*)) |
| (6S,1'S)-(+)-hernandulcin |
| (S-(R*,R*))-6-(1-Hydroxy-1,5-dimethyl-4-hexenyl)-3-methyl-2-cyclohexen-1-one |
| hernandulcin |
| (6S,1'S)-6-(1'-hydroxy-1',5'-dimethyl-4'-hexenyl)-3-methyl-2-cyclohexenone |