Trimethyl(9-phenanthryl)stannane structure
|
Common Name | Trimethyl(9-phenanthryl)stannane | ||
|---|---|---|---|---|
| CAS Number | 957-74-4 | Molecular Weight | 341.02600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(phenanthren-9-yl)stannane |
|---|
| Molecular Formula | C17H18Sn |
|---|---|
| Molecular Weight | 341.02600 |
| Exact Mass | 342.04300 |
| LogP | 4.53820 |
| InChIKey | IVQQCKXNHQQXDW-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)c1cc2ccccc2c2ccccc12 |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |