BTZ043 Racemate structure
|
Common Name | BTZ043 Racemate | ||
|---|---|---|---|---|
| CAS Number | 957217-65-1 | Molecular Weight | 431.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16F3N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BTZ043 RacemateBTZ043 Racemate is the racemate of BTZ043, BTZ043 is an inhibitor of decaprenyl-phosphoribose-epimerase (DprE1), and the antimicrobial activity of BTZ043 is more potent than BTZ043 Racemate. |
| Name | 2-(3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | BTZ043 Racemate is the racemate of BTZ043, BTZ043 is an inhibitor of decaprenyl-phosphoribose-epimerase (DprE1), and the antimicrobial activity of BTZ043 is more potent than BTZ043 Racemate. |
|---|---|
| Related Catalog | |
| Target |
DprE1[1]. |
| References |
| Molecular Formula | C17H16F3N3O5S |
|---|---|
| Molecular Weight | 431.38600 |
| Exact Mass | 431.07600 |
| PSA | 125.72000 |
| LogP | 3.90350 |
| InChIKey | GTUIRORNXIOHQR-UHFFFAOYSA-N |
| SMILES | CC1COC2(CCN(c3nc(=O)c4cc(C(F)(F)F)cc([N+](=O)[O-])c4s3)CC2)O1 |
| Storage condition | -20℃ |
| BTZ038 |
| BTZ038,BTZ044 |
| BTZ043 Racemate |
| BTZ043,BTZ038,BTZ044 |
| BTZ043 |
| BTZ044 |
| 2-{2-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl}-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |