11,12-leukotriene A4 structure
|
Common Name | 11,12-leukotriene A4 | ||
|---|---|---|---|---|
| CAS Number | 95722-34-2 | Molecular Weight | 318.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5E,7E,9E)-10-[(2S,3S)-3-[(E)-oct-2-enyl]oxiran-2-yl]deca-5,7,9-trienoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H30O3 |
|---|---|
| Molecular Weight | 318.45000 |
| Exact Mass | 318.21900 |
| PSA | 49.83000 |
| LogP | 5.20390 |
| InChIKey | VFTVUGKTWCHJEC-OZOOMDLWSA-N |
| SMILES | CCCCCC=CCC1OC1C=CC=CC=CCCCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 11,12-Oxido-5,7,9,14-eicosatetraenoic acid |
| 11,12-Leukotriene A4 |