5β-Dutasteride structure
|
Common Name | 5β-Dutasteride | ||
|---|---|---|---|---|
| CAS Number | 957229-52-6 | Molecular Weight | 528.53000 | |
| Density | 1.303±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 620.3±55.0 °C (760 mmHg) | |
| Molecular Formula | C27H30F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5β-Dutasteride5β-Dutasteride is the S configuration of Dutasteride. 5β-Dutasteride is a potent inhibitor of both 5 alpha-reductase isozymes[1]. |
| Name | 1H-Indeno[5,4-f]quinoline-7-carboxamide, N-[2,5-bis(trifluoromethyl)phenyl]-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, (4aR,4bS,6aS,7S,9aS,9bS,11aS) |
|---|---|
| Synonym | More Synonyms |
| Description | 5β-Dutasteride is the S configuration of Dutasteride. 5β-Dutasteride is a potent inhibitor of both 5 alpha-reductase isozymes[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.303±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 620.3±55.0 °C (760 mmHg) |
| Molecular Formula | C27H30F6N2O2 |
| Molecular Weight | 528.53000 |
| Exact Mass | 528.22100 |
| PSA | 58.20000 |
| LogP | 6.97790 |
| InChIKey | JWJOTENAMICLJG-LKOHVCGWSA-N |
| SMILES | CC12C=CC(=O)NC1CCC1C2CCC2(C)C(C(=O)Nc3cc(C(F)(F)F)ccc3C(F)(F)F)CCC12 |
| 5β-Dutasteride |
| 5-Beta-Dutasteride |
| Dutasteride Impurity 2 |