Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl)
Modify Date: 2025-09-10 18:58:37
Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) structure
|
Common Name | Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 95748-27-9 | Molecular Weight | 492.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32N2O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H32N2O5S2 |
|---|---|
| Molecular Weight | 492.7 |
| InChIKey | HKAVPPLAXREFKO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC2CCOCCC2CCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl)? |
| A: InChIKey of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) is HKAVPPLAXREFKO-UHFFFAOYSA-N. |
| Q: What is the English name of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl)? |
| A: The English name of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) is Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl). |
| Q: What is the CAS number of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl)? |
| A: CAS number of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) is 95748-27-9. |
| Q: What is the SMILES notation of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl)? |
| A: SMILES notation of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) is Cc1ccc(S(=O)(=O)N2CCC2CCOCCC2CCN2S(=O)(=O)c2ccc(C)cc2)cc1. |
| Q: What is the molecular weight of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl)? |
| A: Molecular weight of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) is 492.7. |
| Q: What is the molecular formula of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl)? |
| A: Molecular formula of Azetidine, 2,2a(2)-(oxydiethylene)bis[1-(p-tolylsulfonyl) is C24H32N2O5S2. |
| Q: What is the Chinese name of 95748-27-9? |
| A: Chinese name of 95748-27-9 is 95748-27-9. |