2-METHYL-5-[1,2,4]TRIAZOL-4-YL-PHENYLAMINE structure
|
Common Name | 2-METHYL-5-[1,2,4]TRIAZOL-4-YL-PHENYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 957509-90-9 | Molecular Weight | 222.62800 | |
| Density | 1.42g/cm3 | Boiling Point | 393.6ºC at 760 mmHg | |
| Molecular Formula | C10H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | 2-chloro-5-pyrazol-1-ylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 393.6ºC at 760 mmHg |
| Molecular Formula | C10H7ClN2O2 |
| Molecular Weight | 222.62800 |
| Flash Point | 191.8ºC |
| Exact Mass | 222.02000 |
| PSA | 55.12000 |
| LogP | 2.22390 |
| Index of Refraction | 1.649 |
| InChIKey | IJWPYVIFFDSOQM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-n2cccn2)ccc1Cl |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-5-pyrazolylbenzoic acid |
| BB_SC-4892 |